About N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide
N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide (PubChem CID 19707702) has the molecular formula C27H27Cl2N3O2
and a molecular weight of 496.44 g/mol. Its IUPAC name is N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide.
Molecular Properties
| Compound Name | N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide |
| PubChem CID | 19707702 |
| Molecular Formula | C27H27Cl2N3O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide |
| SMILES | CCCC(NC(=O)c1ccc2oc3ccccc3c2c1)N1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C27H27Cl2N3O2/c1-2-6-25(32-15-13-31(14-16-32)22-9-5-8-21(28)26(22)29)30-27(33)18-11-12-24-20(17-18)19-7-3-4-10-23(19)34-24/h3-5,7-12,17,25H,2,6,13-16H2,1H3,(H,30,33) |
| InChIKey | DIXCXNFBGUUARQ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide?
The IUPAC name of N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide (CID 19707702) is N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide.
What is the SMILES notation for N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide?
The canonical SMILES for N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide is CCCC(NC(=O)c1ccc2oc3ccccc3c2c1)N1CCN(c2cccc(Cl)c2Cl)CC1.
What is the InChIKey of N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide?
The InChIKey is DIXCXNFBGUUARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27Cl2N3O2/c1-2-6-25(32-15-13-31(14-16-32)22-9-5-8-21(28)26(22)29)30-27(33)18-11-12-24-20(17-18)19-7-3-4-10-23(19)34-24/h3-5,7-12,17,25H,2,6,13-16H2,1H3,(H,30,33).
What are the key properties of N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide?
N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide has a molecular weight of 496.44 g/mol, XLogP of 6.57, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]dibenzofuran-2-carboxamide is sourced from PubChem (CID 19707702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).