About ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate
ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate (PubChem CID 19708160) has the molecular formula C9H16N4O4
and a molecular weight of 244.25 g/mol. Its IUPAC name is ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate |
| PubChem CID | 19708160 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate |
| SMILES | CCOC(=O)N(N)CCCC1NC(=O)NC1=O |
| InChI | InChI=1S/C9H16N4O4/c1-2-17-9(16)13(10)5-3-4-6-7(14)12-8(15)11-6/h6H,2-5,10H2,1H3,(H2,11,12,14,15) |
| InChIKey | WJHKZAKSXZEBQV-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate?
The IUPAC name of ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate (CID 19708160) is ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate.
What is the SMILES notation for ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate?
The canonical SMILES for ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate is CCOC(=O)N(N)CCCC1NC(=O)NC1=O.
What is the InChIKey of ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate?
The InChIKey is WJHKZAKSXZEBQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O4/c1-2-17-9(16)13(10)5-3-4-6-7(14)12-8(15)11-6/h6H,2-5,10H2,1H3,(H2,11,12,14,15).
What are the key properties of ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate?
ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate has a molecular weight of 244.25 g/mol, XLogP of -0.69, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-amino-N-[3-(2,5-dioxoimidazolidin-4-yl)propyl]carbamate is sourced from PubChem (CID 19708160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).