C18H28N2 — CID 19708208
1-N,3-N-dicyclohexylbenzene-1,3-diamine (PubChem CID 19708208) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-N,3-N-dicyclohexylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-dicyclohexylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 19708208 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-N,3-N-dicyclohexylbenzene-1,3-diamine |
| SMILES | c1cc(NC2CCCCC2)cc(NC2CCCCC2)c1 |
| InChI | InChI=1S/C18H28N2/c1-3-8-15(9-4-1)19-17-12-7-13-18(14-17)20-16-10-5-2-6-11-16/h7,12-16,19-20H,1-6,8-11H2 |
| InChIKey | IRCKYYPETYCQBQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |