C21H17ClFN7O4 — CID 19709063
2-[[4-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 19709063) has the molecular formula C21H17ClFN7O4 and a molecular weight of 485.86 g/mol. Its IUPAC name is 2-[[4-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | 2-[[4-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 19709063 |
| Molecular Formula | C21H17ClFN7O4 |
| Molecular Weight | 485.86 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 2-[[4-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(C(O)C(CO)Nc2ncc3ncnc(Nc4ccc(F)c(Cl)c4)c3n2)cc1 |
| InChI | InChI=1S/C21H17ClFN7O4/c22-14-7-12(3-6-15(14)23)27-20-18-16(25-10-26-20)8-24-21(29-18)28-17(9-31)19(32)11-1-4-13(5-2-11)30(33)34/h1-8,10,17,19,31-32H,9H2,(H,24,28,29)(H,25,26,27) |
| InChIKey | HXTPAKCUIPPYQX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|