About 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone
1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone (PubChem CID 19709527) has the molecular formula C16H21FN2O
and a molecular weight of 276.35 g/mol. Its IUPAC name is 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone.
Molecular Properties
| Compound Name | 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone |
| PubChem CID | 19709527 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone |
| SMILES | CC1(C)CCCN(C(=O)C/N=C/c2ccccc2F)C1 |
| InChI | InChI=1S/C16H21FN2O/c1-16(2)8-5-9-19(12-16)15(20)11-18-10-13-6-3-4-7-14(13)17/h3-4,6-7,10H,5,8-9,11-12H2,1-2H3/b18-10+ |
| InChIKey | PWHZASQHYYSTLP-VCHYOVAHSA-N |
| XLogP | 2.89 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone?
The IUPAC name of 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone (CID 19709527) is 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone.
What is the SMILES notation for 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone?
The canonical SMILES for 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone is CC1(C)CCCN(C(=O)C/N=C/c2ccccc2F)C1.
What is the InChIKey of 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone?
The InChIKey is PWHZASQHYYSTLP-VCHYOVAHSA-N. The full InChI is InChI=1S/C16H21FN2O/c1-16(2)8-5-9-19(12-16)15(20)11-18-10-13-6-3-4-7-14(13)17/h3-4,6-7,10H,5,8-9,11-12H2,1-2H3/b18-10+.
What are the key properties of 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone?
1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone has a molecular weight of 276.35 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylideneamino]ethanone is sourced from PubChem (CID 19709527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).