About ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate
ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate (PubChem CID 19709607) has the molecular formula C27H35NO5
and a molecular weight of 453.58 g/mol. Its IUPAC name is ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate |
| PubChem CID | 19709607 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(Cc2ccccc2)C(O)(c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H35NO5/c1-25(2,3)32-23(29)22-18-21(17-19-13-9-7-10-14-19)27(31,20-15-11-8-12-16-20)28(22)24(30)33-26(4,5)6/h7-16,21-22,31H,17-18H2,1-6H3 |
| InChIKey | CFDXYWJXGFGLOV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate?
The IUPAC name of ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate (CID 19709607) is ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)C1CC(Cc2ccccc2)C(O)(c2ccccc2)N1C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate?
The InChIKey is CFDXYWJXGFGLOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35NO5/c1-25(2,3)32-23(29)22-18-21(17-19-13-9-7-10-14-19)27(31,20-15-11-8-12-16-20)28(22)24(30)33-26(4,5)6/h7-16,21-22,31H,17-18H2,1-6H3.
What are the key properties of ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate?
ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate has a molecular weight of 453.58 g/mol, XLogP of 5.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 4-benzyl-5-hydroxy-5-phenylpyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 19709607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).