About 5-butylpyrazolo[1,5-a]pyrimidin-7-amine
5-butylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 19709702) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-butylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 5-butylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 19709702 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 5-butylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCc1cc(N)n2nccc2n1 |
| InChI | InChI=1S/C10H14N4/c1-2-3-4-8-7-9(11)14-10(13-8)5-6-12-14/h5-7H,2-4,11H2,1H3 |
| InChIKey | WMLBPFXDYDINND-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 5-butylpyrazolo[1,5-a]pyrimidin-7-amine (CID 19709702) is 5-butylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 5-butylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 5-butylpyrazolo[1,5-a]pyrimidin-7-amine is CCCCc1cc(N)n2nccc2n1.
What is the InChIKey of 5-butylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is WMLBPFXDYDINND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-2-3-4-8-7-9(11)14-10(13-8)5-6-12-14/h5-7H,2-4,11H2,1H3.
What are the key properties of 5-butylpyrazolo[1,5-a]pyrimidin-7-amine?
5-butylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 190.25 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 19709702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).