C15H20N2O — CID 19710160
N-(5-ethyl-5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 19710160) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-(5-ethyl-5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | N-(5-ethyl-5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 19710160 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-(5-ethyl-5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCC1CCCc2c(NC3=NCCO3)cccc21 |
| InChI | InChI=1S/C15H20N2O/c1-2-11-5-3-7-13-12(11)6-4-8-14(13)17-15-16-9-10-18-15/h4,6,8,11H,2-3,5,7,9-10H2,1H3,(H,16,17) |
| InChIKey | IQKRJAMDGBLUQZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |