About 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde
2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde (PubChem CID 19710217) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde |
| PubChem CID | 19710217 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde |
| SMILES | CCCN(CCC)C1Cc2ccc(C=O)cc2C1 |
| InChI | InChI=1S/C16H23NO/c1-3-7-17(8-4-2)16-10-14-6-5-13(12-18)9-15(14)11-16/h5-6,9,12,16H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | NPDDWRDMYONMRW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde?
The IUPAC name of 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde (CID 19710217) is 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde.
What is the SMILES notation for 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde?
The canonical SMILES for 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde is CCCN(CCC)C1Cc2ccc(C=O)cc2C1.
What is the InChIKey of 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde?
The InChIKey is NPDDWRDMYONMRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-3-7-17(8-4-2)16-10-14-6-5-13(12-18)9-15(14)11-16/h5-6,9,12,16H,3-4,7-8,10-11H2,1-2H3.
What are the key properties of 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde?
2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde has a molecular weight of 245.37 g/mol, XLogP of 3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dipropylamino)-2,3-dihydro-1H-indene-5-carbaldehyde is sourced from PubChem (CID 19710217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).