C20H23Cl2N3O4Se — CID 19710708
[6-(dimethylamino)-3,5-dimethyl-6'-nitrospiro[1,3-benzoselenazole-2,2'-chromene]-8'-yl]methanol;dihydrochloride (PubChem CID 19710708) has the molecular formula C20H23Cl2N3O4Se and a molecular weight of 519.29 g/mol. Its IUPAC name is [6-(dimethylamino)-3,5-dimethyl-6'-nitrospiro[1,3-benzoselenazole-2,2'-chromene]-8'-yl]methanol;dihydrochloride.
| Compound Name | [6-(dimethylamino)-3,5-dimethyl-6'-nitrospiro[1,3-benzoselenazole-2,2'-chromene]-8'-yl]methanol;dihydrochloride |
|---|---|
| PubChem CID | 19710708 |
| Molecular Formula | C20H23Cl2N3O4Se |
| Molecular Weight | 519.29 g/mol |
| Exact Mass | 519.02 |
| IUPAC Name | [6-(dimethylamino)-3,5-dimethyl-6'-nitrospiro[1,3-benzoselenazole-2,2'-chromene]-8'-yl]methanol;dihydrochloride |
| SMILES | Cc1cc2c(cc1N(C)C)[Se]C1(C=Cc3cc([N+](=O)[O-])cc(CO)c3O1)N2C.Cl.Cl |
| InChI | InChI=1S/C20H21N3O4Se.2ClH/c1-12-7-17-18(10-16(12)21(2)3)28-20(22(17)4)6-5-13-8-15(23(25)26)9-14(11-24)19(13)27-20;;/h5-10,24H,11H2,1-4H3;2*1H |
| InChIKey | LASFKCKCFBUOJE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|