C10H15ClF7NO2S — CID 19711032
5-chloro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-N-methylpentane-1-sulfonamide (PubChem CID 19711032) has the molecular formula C10H15ClF7NO2S and a molecular weight of 381.74 g/mol. Its IUPAC name is 5-chloro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-N-methylpentane-1-sulfonamide.
| Compound Name | 5-chloro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-N-methylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 19711032 |
| Molecular Formula | C10H15ClF7NO2S |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 5-chloro-N-(2,2,3,3,4,4,4-heptafluorobutyl)-N-methylpentane-1-sulfonamide |
| SMILES | CN(CC(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)CCCCCCl |
| InChI | InChI=1S/C10H15ClF7NO2S/c1-19(22(20,21)6-4-2-3-5-11)7-8(12,13)9(14,15)10(16,17)18/h2-7H2,1H3 |
| InChIKey | CJCXLVIDLCJUPR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|