C20H22N4O3S2 — CID 19715940
methyl 2-[[2-[(5-methyl-4-propyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19715940) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is methyl 2-[[2-[(5-methyl-4-propyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(5-methyl-4-propyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19715940 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | methyl 2-[[2-[(5-methyl-4-propyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCCn1c(C)nnc1SCC(=O)Nc1scc(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C20H22N4O3S2/c1-4-10-24-13(2)22-23-20(24)29-12-16(25)21-18-17(19(26)27-3)15(11-28-18)14-8-6-5-7-9-14/h5-9,11H,4,10,12H2,1-3H3,(H,21,25) |
| InChIKey | GLZCHMLVINRRQZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|