C18H18BrN5OS2 — CID 19718840
N-(5-bromo-2-pyridinyl)-2-[[5-(5-ethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19718840) has the molecular formula C18H18BrN5OS2 and a molecular weight of 464.41 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-[[5-(5-ethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-[[5-(5-ethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19718840 |
| Molecular Formula | C18H18BrN5OS2 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-[[5-(5-ethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(Br)cn2)nnc1-c1csc(CC)c1 |
| InChI | InChI=1S/C18H18BrN5OS2/c1-3-7-24-17(12-8-14(4-2)26-10-12)22-23-18(24)27-11-16(25)21-15-6-5-13(19)9-20-15/h3,5-6,8-10H,1,4,7,11H2,2H3,(H,20,21,25) |
| InChIKey | OCJRDDAJEPLWMF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|