C20H22ClN3S2 — CID 19722468
3-[(2-chlorophenyl)methylsulfanyl]-4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazole (PubChem CID 19722468) has the molecular formula C20H22ClN3S2 and a molecular weight of 404.00 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylsulfanyl]-4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazole.
| Compound Name | 3-[(2-chlorophenyl)methylsulfanyl]-4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 19722468 |
| Molecular Formula | C20H22ClN3S2 |
| Molecular Weight | 404.00 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 3-[(2-chlorophenyl)methylsulfanyl]-4-propan-2-yl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazole |
| SMILES | CC(C)n1c(SCc2ccccc2Cl)nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C20H22ClN3S2/c1-13(2)24-19(16-12-25-18-10-6-4-8-15(16)18)22-23-20(24)26-11-14-7-3-5-9-17(14)21/h3,5,7,9,12-13H,4,6,8,10-11H2,1-2H3 |
| InChIKey | KZRWBDYRWYMJOQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.00 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |