C21H18ClN5O3S2 — CID 19723824
2-[[5-(1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 19723824) has the molecular formula C21H18ClN5O3S2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 2-[[5-(1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19723824 |
| Molecular Formula | C21H18ClN5O3S2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 2-[[5-(1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)nnc1-c1csc2ccccc12 |
| InChI | InChI=1S/C21H18ClN5O3S2/c1-2-9-26-20(15-11-31-18-6-4-3-5-14(15)18)24-25-21(26)32-12-19(28)23-17-10-13(27(29)30)7-8-16(17)22/h3-8,10-11H,2,9,12H2,1H3,(H,23,28) |
| InChIKey | YRYMUPPOLHKAGS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|