C19H20N4O3S3 — CID 19725419
methyl 2-[[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19725419) has the molecular formula C19H20N4O3S3 and a molecular weight of 448.60 g/mol. Its IUPAC name is methyl 2-[[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19725419 |
| Molecular Formula | C19H20N4O3S3 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | methyl 2-[[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2nnc(-c3cccs3)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C19H20N4O3S3/c1-23-16(13-8-5-9-27-13)21-22-19(23)28-10-14(24)20-17-15(18(25)26-2)11-6-3-4-7-12(11)29-17/h5,8-9H,3-4,6-7,10H2,1-2H3,(H,20,24) |
| InChIKey | RUGHWHHCNHMURG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |