C16H14N2O4 — CID 19729
1,5-dihydroxy-4,8-bis(methylamino)anthracene-9,10-dione (PubChem CID 19729) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 1,5-dihydroxy-4,8-bis(methylamino)anthracene-9,10-dione.
| Compound Name | 1,5-dihydroxy-4,8-bis(methylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 19729 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1,5-dihydroxy-4,8-bis(methylamino)anthracene-9,10-dione |
| SMILES | CNc1ccc(O)c2c1C(=O)c1c(O)ccc(NC)c1C2=O |
| InChI | InChI=1S/C16H14N2O4/c1-17-7-3-5-9(19)13-11(7)15(21)14-10(20)6-4-8(18-2)12(14)16(13)22/h3-6,17-20H,1-2H3 |
| InChIKey | OKZNPGWYVNZKKZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|