C22H23N5OS2 — CID 19729974
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-methyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19729974) has the molecular formula C22H23N5OS2 and a molecular weight of 437.59 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-methyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-methyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19729974 |
| Molecular Formula | C22H23N5OS2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-methyl-5-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1cccc(-c2nnc(SCC(=O)Nc3sc4c(c3C#N)CCCCC4)n2C)c1 |
| InChI | InChI=1S/C22H23N5OS2/c1-14-7-6-8-15(11-14)20-25-26-22(27(20)2)29-13-19(28)24-21-17(12-23)16-9-4-3-5-10-18(16)30-21/h6-8,11H,3-5,9-10,13H2,1-2H3,(H,24,28) |
| InChIKey | RPTBEIGHHQSODS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |