C18H16ClN5O4S — CID 19733418
2-[[5-[(4-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 19733418) has the molecular formula C18H16ClN5O4S and a molecular weight of 433.88 g/mol. Its IUPAC name is 2-[[5-[(4-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[(4-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19733418 |
| Molecular Formula | C18H16ClN5O4S |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 2-[[5-[(4-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | Cn1c(COc2ccc(Cl)cc2)nnc1SCC(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16ClN5O4S/c1-23-16(10-28-13-8-6-12(19)7-9-13)21-22-18(23)29-11-17(25)20-14-4-2-3-5-15(14)24(26)27/h2-9H,10-11H2,1H3,(H,20,25) |
| InChIKey | PQKOAXXAOCQPCZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|