C32H16F18OS2 — CID 19733999
1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3-[3-[4-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]sulfanylphenoxy]phenyl]sulfanylbenzene (PubChem CID 19733999) has the molecular formula C32H16F18OS2 and a molecular weight of 822.58 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3-[3-[4-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]sulfanylphenoxy]phenyl]sulfanylbenzene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3-[3-[4-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]sulfanylphenoxy]phenyl]sulfanylbenzene |
|---|---|
| PubChem CID | 19733999 |
| Molecular Formula | C32H16F18OS2 |
| Molecular Weight | 822.58 g/mol |
| Exact Mass | 822.04 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3-[3-[4-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]sulfanylphenoxy]phenyl]sulfanylbenzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cccc(Sc2ccc(Oc3cccc(Sc4cccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c4)c3)cc2)c1 |
| InChI | InChI=1S/C32H16F18OS2/c33-25(34,27(37,38)29(41,42)31(45,46)47)17-4-1-7-22(14-17)52-21-12-10-19(11-13-21)51-20-6-3-9-24(16-20)53-23-8-2-5-18(15-23)26(35,36)28(39,40)30(43,44)32(48,49)50/h1-16H |
| InChIKey | VMPNKQAZDKWNMC-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.58 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|