About 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide
6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide (PubChem CID 19734) has the molecular formula C11H9ClN2O4S
and a molecular weight of 300.72 g/mol. Its IUPAC name is 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide |
| PubChem CID | 19734 |
| Molecular Formula | C11H9ClN2O4S |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide |
| SMILES | C=CCN1C(=O)c2cc(Cl)c(S(N)(=O)=O)cc2C1=O |
| InChI | InChI=1S/C11H9ClN2O4S/c1-2-3-14-10(15)6-4-8(12)9(19(13,17)18)5-7(6)11(14)16/h2,4-5H,1,3H2,(H2,13,17,18) |
| InChIKey | LDTCLBDGNNENEM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide?
The IUPAC name of 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide (CID 19734) is 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide.
What is the SMILES notation for 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide?
The canonical SMILES for 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide is C=CCN1C(=O)c2cc(Cl)c(S(N)(=O)=O)cc2C1=O.
What is the InChIKey of 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide?
The InChIKey is LDTCLBDGNNENEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O4S/c1-2-3-14-10(15)6-4-8(12)9(19(13,17)18)5-7(6)11(14)16/h2,4-5H,1,3H2,(H2,13,17,18).
What are the key properties of 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide?
6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide has a molecular weight of 300.72 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,3-dioxo-2-prop-2-enylisoindole-5-sulfonamide is sourced from PubChem (CID 19734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).