About 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one
2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one (PubChem CID 19734610) has the molecular formula C20H18BrNO3
and a molecular weight of 400.27 g/mol. Its IUPAC name is 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one |
| PubChem CID | 19734610 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one |
| SMILES | CC1(C)C(=O)c2ccc(Br)cc2C(N2Cc3ccccc3C2=O)C1O |
| InChI | InChI=1S/C20H18BrNO3/c1-20(2)17(23)14-8-7-12(21)9-15(14)16(18(20)24)22-10-11-5-3-4-6-13(11)19(22)25/h3-9,16,18,24H,10H2,1-2H3 |
| InChIKey | ZYSQGZQAPTXOEJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one?
The IUPAC name of 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one (CID 19734610) is 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one.
What is the SMILES notation for 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one?
The canonical SMILES for 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one is CC1(C)C(=O)c2ccc(Br)cc2C(N2Cc3ccccc3C2=O)C1O.
What is the InChIKey of 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one?
The InChIKey is ZYSQGZQAPTXOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BrNO3/c1-20(2)17(23)14-8-7-12(21)9-15(14)16(18(20)24)22-10-11-5-3-4-6-13(11)19(22)25/h3-9,16,18,24H,10H2,1-2H3.
What are the key properties of 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one?
2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one has a molecular weight of 400.27 g/mol, XLogP of 3.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-2-hydroxy-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl)-3H-isoindol-1-one is sourced from PubChem (CID 19734610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).