About 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal
3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal (PubChem CID 19734901) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal.
Molecular Properties
| Compound Name | 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal |
| PubChem CID | 19734901 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal |
| SMILES | CC(C)(C)c1cc(C(CC=O)C(C)(C)C)ccc1O |
| InChI | InChI=1S/C17H26O2/c1-16(2,3)13(9-10-18)12-7-8-15(19)14(11-12)17(4,5)6/h7-8,10-11,13,19H,9H2,1-6H3 |
| InChIKey | HQGXOXFWSZRDOX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal?
The IUPAC name of 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal (CID 19734901) is 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal.
What is the SMILES notation for 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal?
The canonical SMILES for 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal is CC(C)(C)c1cc(C(CC=O)C(C)(C)C)ccc1O.
What is the InChIKey of 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal?
The InChIKey is HQGXOXFWSZRDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-16(2,3)13(9-10-18)12-7-8-15(19)14(11-12)17(4,5)6/h7-8,10-11,13,19H,9H2,1-6H3.
What are the key properties of 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal?
3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal has a molecular weight of 262.39 g/mol, XLogP of 4.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanal is sourced from PubChem (CID 19734901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).