C11H18O4 — CID 19734990
benzene-1,4-diol;2,2-dimethylpropane-1,3-diol (PubChem CID 19734990) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is benzene-1,4-diol;2,2-dimethylpropane-1,3-diol.
| Compound Name | benzene-1,4-diol;2,2-dimethylpropane-1,3-diol |
|---|---|
| PubChem CID | 19734990 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | benzene-1,4-diol;2,2-dimethylpropane-1,3-diol |
| SMILES | CC(C)(CO)CO.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C5H12O2/c7-5-1-2-6(8)4-3-5;1-5(2,3-6)4-7/h1-4,7-8H;6-7H,3-4H2,1-2H3 |
| InChIKey | DWEMPDNPLNEZQT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|