About sulfinamoyloxymethane
sulfinamoyloxymethane (PubChem CID 19735092) has the molecular formula CH5NO2S
and a molecular weight of 95.12 g/mol. Its IUPAC name is sulfinamoyloxymethane.
Molecular Properties
| Compound Name | sulfinamoyloxymethane |
| PubChem CID | 19735092 |
| Molecular Formula | CH5NO2S |
| Molecular Weight | 95.12 g/mol |
| Exact Mass | 95.00 |
| IUPAC Name | sulfinamoyloxymethane |
| SMILES | COS(N)=O |
| InChI | InChI=1S/CH5NO2S/c1-4-5(2)3/h2H2,1H3 |
| InChIKey | GFCOONGEHPUULZ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.12 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sulfinamoyloxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfinamoyloxymethane?
The IUPAC name of sulfinamoyloxymethane (CID 19735092) is sulfinamoyloxymethane.
What is the SMILES notation for sulfinamoyloxymethane?
The canonical SMILES for sulfinamoyloxymethane is COS(N)=O.
What is the InChIKey of sulfinamoyloxymethane?
The InChIKey is GFCOONGEHPUULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5NO2S/c1-4-5(2)3/h2H2,1H3.
What are the key properties of sulfinamoyloxymethane?
sulfinamoyloxymethane has a molecular weight of 95.12 g/mol, XLogP of -0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfinamoyloxymethane is sourced from PubChem (CID 19735092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).