C7H5Cl5 — CID 19736081
1,4,5,7,7-pentachlorobicyclo[2.2.1]hept-2-ene (PubChem CID 19736081) has the molecular formula C7H5Cl5 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1,4,5,7,7-pentachlorobicyclo[2.2.1]hept-2-ene.
| Compound Name | 1,4,5,7,7-pentachlorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 19736081 |
| Molecular Formula | C7H5Cl5 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 263.88 |
| IUPAC Name | 1,4,5,7,7-pentachlorobicyclo[2.2.1]hept-2-ene |
| SMILES | ClC1CC2(Cl)C=CC1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C7H5Cl5/c8-4-3-5(9)1-2-6(4,10)7(5,11)12/h1-2,4H,3H2 |
| InChIKey | QEQKSTSTIXJRDW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|