C14H19N3O3 — CID 19736179
1-isocyanato-1,3-bis(isocyanatomethyl)-3,5,5-trimethylcyclohexane (PubChem CID 19736179) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-isocyanato-1,3-bis(isocyanatomethyl)-3,5,5-trimethylcyclohexane.
| Compound Name | 1-isocyanato-1,3-bis(isocyanatomethyl)-3,5,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 19736179 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-isocyanato-1,3-bis(isocyanatomethyl)-3,5,5-trimethylcyclohexane |
| SMILES | CC1(C)CC(C)(CN=C=O)CC(CN=C=O)(N=C=O)C1 |
| InChI | InChI=1S/C14H19N3O3/c1-12(2)4-13(3,7-15-9-18)6-14(5-12,17-11-20)8-16-10-19/h4-8H2,1-3H3 |
| InChIKey | ANDSVUDTFOBZEU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|