About 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol
2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol (PubChem CID 19736422) has the molecular formula C14H27F2NOS
and a molecular weight of 295.44 g/mol. Its IUPAC name is 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol.
Molecular Properties
| Compound Name | 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol |
| PubChem CID | 19736422 |
| Molecular Formula | C14H27F2NOS |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol |
| SMILES | CC(C)C(S)C(F)(F)C(O)C(N)CC1CCCCC1 |
| InChI | InChI=1S/C14H27F2NOS/c1-9(2)13(19)14(15,16)12(18)11(17)8-10-6-4-3-5-7-10/h9-13,18-19H,3-8,17H2,1-2H3 |
| InChIKey | OJOQJHFODWMXAM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol?
The IUPAC name of 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol (CID 19736422) is 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol.
What is the SMILES notation for 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol?
The canonical SMILES for 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol is CC(C)C(S)C(F)(F)C(O)C(N)CC1CCCCC1.
What is the InChIKey of 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol?
The InChIKey is OJOQJHFODWMXAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27F2NOS/c1-9(2)13(19)14(15,16)12(18)11(17)8-10-6-4-3-5-7-10/h9-13,18-19H,3-8,17H2,1-2H3.
What are the key properties of 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol?
2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol has a molecular weight of 295.44 g/mol, XLogP of 3.23, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-cyclohexyl-4,4-difluoro-6-methyl-5-sulfanylheptan-3-ol is sourced from PubChem (CID 19736422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).