About ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate
ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate (PubChem CID 19736600) has the molecular formula C12H10ClNO4
and a molecular weight of 267.67 g/mol. Its IUPAC name is ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate |
| PubChem CID | 19736600 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)Nc2cc(Cl)ccc2C1=O |
| InChI | InChI=1S/C12H10ClNO4/c1-2-18-12(17)9-10(15)7-4-3-6(13)5-8(7)14-11(9)16/h3-5,9H,2H2,1H3,(H,14,16) |
| InChIKey | GBMOJDJVGGJORT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate?
The IUPAC name of ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate (CID 19736600) is ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate.
What is the SMILES notation for ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate?
The canonical SMILES for ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate is CCOC(=O)C1C(=O)Nc2cc(Cl)ccc2C1=O.
What is the InChIKey of ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate?
The InChIKey is GBMOJDJVGGJORT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO4/c1-2-18-12(17)9-10(15)7-4-3-6(13)5-8(7)14-11(9)16/h3-5,9H,2H2,1H3,(H,14,16).
What are the key properties of ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate?
ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate has a molecular weight of 267.67 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-chloro-2,4-dioxo-1H-quinoline-3-carboxylate is sourced from PubChem (CID 19736600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).