C16H33N3O — CID 19736767
2,2,6,6-tetramethyl-N-(3-morpholin-4-ylpropyl)piperidin-4-amine (PubChem CID 19736767) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-(3-morpholin-4-ylpropyl)piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-(3-morpholin-4-ylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 19736767 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-(3-morpholin-4-ylpropyl)piperidin-4-amine |
| SMILES | CC1(C)CC(NCCCN2CCOCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H33N3O/c1-15(2)12-14(13-16(3,4)18-15)17-6-5-7-19-8-10-20-11-9-19/h14,17-18H,5-13H2,1-4H3 |
| InChIKey | BNLJEJATHCDCLN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|