About 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene
1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene (PubChem CID 19736981) has the molecular formula C16H16Cl2O2S
and a molecular weight of 343.28 g/mol. Its IUPAC name is 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene |
| PubChem CID | 19736981 |
| Molecular Formula | C16H16Cl2O2S |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene |
| SMILES | Cc1cc(S(=O)(=O)c2cc(C)c(Cl)cc2C)c(C)cc1Cl |
| InChI | InChI=1S/C16H16Cl2O2S/c1-9-7-15(11(3)5-13(9)17)21(19,20)16-8-10(2)14(18)6-12(16)4/h5-8H,1-4H3 |
| InChIKey | WESJZFLINNRYDJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene?
The IUPAC name of 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene (CID 19736981) is 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene.
What is the SMILES notation for 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene?
The canonical SMILES for 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene is Cc1cc(S(=O)(=O)c2cc(C)c(Cl)cc2C)c(C)cc1Cl.
What is the InChIKey of 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene?
The InChIKey is WESJZFLINNRYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2O2S/c1-9-7-15(11(3)5-13(9)17)21(19,20)16-8-10(2)14(18)6-12(16)4/h5-8H,1-4H3.
What are the key properties of 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene?
1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene has a molecular weight of 343.28 g/mol, XLogP of 5.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(4-chloro-2,5-dimethylphenyl)sulfonyl-2,5-dimethylbenzene is sourced from PubChem (CID 19736981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).