About 1-bromo-9-ethylcarbazole
1-bromo-9-ethylcarbazole (PubChem CID 19736997) has the molecular formula C14H12BrN
and a molecular weight of 274.16 g/mol. Its IUPAC name is 1-bromo-9-ethylcarbazole.
Molecular Properties
| Compound Name | 1-bromo-9-ethylcarbazole |
| PubChem CID | 19736997 |
| Molecular Formula | C14H12BrN |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-bromo-9-ethylcarbazole |
| SMILES | CCn1c2ccccc2c2cccc(Br)c21 |
| InChI | InChI=1S/C14H12BrN/c1-2-16-13-9-4-3-6-10(13)11-7-5-8-12(15)14(11)16/h3-9H,2H2,1H3 |
| InChIKey | MYTWGZHEZWIILW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-9-ethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-9-ethylcarbazole?
The IUPAC name of 1-bromo-9-ethylcarbazole (CID 19736997) is 1-bromo-9-ethylcarbazole.
What is the SMILES notation for 1-bromo-9-ethylcarbazole?
The canonical SMILES for 1-bromo-9-ethylcarbazole is CCn1c2ccccc2c2cccc(Br)c21.
What is the InChIKey of 1-bromo-9-ethylcarbazole?
The InChIKey is MYTWGZHEZWIILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrN/c1-2-16-13-9-4-3-6-10(13)11-7-5-8-12(15)14(11)16/h3-9H,2H2,1H3.
What are the key properties of 1-bromo-9-ethylcarbazole?
1-bromo-9-ethylcarbazole has a molecular weight of 274.16 g/mol, XLogP of 4.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-9-ethylcarbazole is sourced from PubChem (CID 19736997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).