About CID 19737039
CID 19737039 (PubChem CID 19737039) has the molecular formula CH4O5Si4
and a molecular weight of 208.38 g/mol.
Molecular Properties
| Compound Name | CID 19737039 |
| PubChem CID | 19737039 |
| Molecular Formula | CH4O5Si4 |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 207.91 |
| IUPAC Name | — |
| SMILES | C[Si]1(O)O[Si]O[Si]O[Si]O1 |
| InChI | InChI=1S/CH4O5Si4/c1-10(2)5-8-3-7-4-9-6-10/h2H,1H3 |
| InChIKey | JPHKEBAVLISNND-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19737039 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19737039?
The IUPAC name of CID 19737039 (CID 19737039) is not available.
What is the SMILES notation for CID 19737039?
The canonical SMILES for CID 19737039 is C[Si]1(O)O[Si]O[Si]O[Si]O1.
What is the InChIKey of CID 19737039?
The InChIKey is JPHKEBAVLISNND-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O5Si4/c1-10(2)5-8-3-7-4-9-6-10/h2H,1H3.
What are the key properties of CID 19737039?
CID 19737039 has a molecular weight of 208.38 g/mol, XLogP of -1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19737039 is sourced from PubChem (CID 19737039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).