About 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine
3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine (PubChem CID 19737100) has the molecular formula C18H42N6
and a molecular weight of 342.58 g/mol. Its IUPAC name is 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 19737100 |
| Molecular Formula | C18H42N6 |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 342.35 |
| IUPAC Name | 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCC1CN(CCCN(C)C)NN(CCCN(C)C)C1 |
| InChI | InChI=1S/C18H42N6/c1-20(2)11-7-10-18-16-23(14-8-12-21(3)4)19-24(17-18)15-9-13-22(5)6/h18-19H,7-17H2,1-6H3 |
| InChIKey | DPXFJZGPVUNVOT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 28.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine (CID 19737100) is 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine is CN(C)CCCC1CN(CCCN(C)C)NN(CCCN(C)C)C1.
What is the InChIKey of 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine?
The InChIKey is DPXFJZGPVUNVOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H42N6/c1-20(2)11-7-10-18-16-23(14-8-12-21(3)4)19-24(17-18)15-9-13-22(5)6/h18-19H,7-17H2,1-6H3.
What are the key properties of 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine?
3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine has a molecular weight of 342.58 g/mol, XLogP of 0.88, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-bis[3-(dimethylamino)propyl]triazinan-5-yl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 19737100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).