C15H14O3 — CID 19737210
(5Z,7Z,9Z,11Z,13Z)-14a-hydroperoxycyclododeca[b]pyran (PubChem CID 19737210) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is (5Z,7Z,9Z,11Z,13Z)-14a-hydroperoxycyclododeca[b]pyran.
| Compound Name | (5Z,7Z,9Z,11Z,13Z)-14a-hydroperoxycyclododeca[b]pyran |
|---|---|
| PubChem CID | 19737210 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (5Z,7Z,9Z,11Z,13Z)-14a-hydroperoxycyclododeca[b]pyran |
| SMILES | OOC12/C=C\C=C/C=C\C=C/C=C\C1=CC=CO2 |
| InChI | InChI=1S/C15H14O3/c16-18-15-12-8-6-4-2-1-3-5-7-10-14(15)11-9-13-17-15/h1-13,16H/b2-1-,5-3-,6-4-,10-7-,12-8- |
| InChIKey | RMAYWVVXZUQCFI-GLYQKPOZSA-N |
| XLogP | 3.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|