About trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide
trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide (PubChem CID 19737531) has the molecular formula C14H7Li3
and a molecular weight of 196.03 g/mol. Its IUPAC name is trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide.
Molecular Properties
| Compound Name | trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide |
| PubChem CID | 19737531 |
| Molecular Formula | C14H7Li3 |
| Molecular Weight | 196.03 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide |
| SMILES | [Li+].[Li+].[Li+].[c-]1c[c-]c2cc3ccc[c-]c3cc2c1 |
| InChI | InChI=1S/C14H7.3Li/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;;;/h1-3,5,8-10H;;;/q-3;3*+1 |
| InChIKey | PPJIBCJTTOBBCF-UHFFFAOYSA-N |
| XLogP | -5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.03 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide?
The IUPAC name of trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide (CID 19737531) is trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide.
What is the SMILES notation for trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide?
The canonical SMILES for trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide is [Li+].[Li+].[Li+].[c-]1c[c-]c2cc3ccc[c-]c3cc2c1.
What is the InChIKey of trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide?
The InChIKey is PPJIBCJTTOBBCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7.3Li/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;;;/h1-3,5,8-10H;;;/q-3;3*+1.
What are the key properties of trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide?
trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide has a molecular weight of 196.03 g/mol, XLogP of -5.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trilithium;3,5-dihydro-1H-anthracene-1,3,5-triide is sourced from PubChem (CID 19737531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).