C15H23NO2 — CID 19737784
3-(5-amino-2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)propan-1-ol (PubChem CID 19737784) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 3-(5-amino-2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)propan-1-ol.
| Compound Name | 3-(5-amino-2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)propan-1-ol |
|---|---|
| PubChem CID | 19737784 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3-(5-amino-2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)propan-1-ol |
| SMILES | Cc1c(N)c(C)c2c(c1CCCO)OC(C)(C)C2 |
| InChI | InChI=1S/C15H23NO2/c1-9-11(6-5-7-17)14-12(10(2)13(9)16)8-15(3,4)18-14/h17H,5-8,16H2,1-4H3 |
| InChIKey | ASPJZEBBOYNONM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|