C14H25N3O6S3 — CID 19737948
4-(ethylamino)-2-[3-(2-methoxyethoxy)propyl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 19737948) has the molecular formula C14H25N3O6S3 and a molecular weight of 427.57 g/mol. Its IUPAC name is 4-(ethylamino)-2-[3-(2-methoxyethoxy)propyl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | 4-(ethylamino)-2-[3-(2-methoxyethoxy)propyl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 19737948 |
| Molecular Formula | C14H25N3O6S3 |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 4-(ethylamino)-2-[3-(2-methoxyethoxy)propyl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | CCNC1CN(CCCOCCOC)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C14H25N3O6S3/c1-3-16-12-10-17(5-4-6-23-8-7-22-2)26(20,21)14-11(12)9-13(24-14)25(15,18)19/h9,12,16H,3-8,10H2,1-2H3,(H2,15,18,19) |
| InChIKey | YPZGURITZFDKQT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|