About 4-(3-chloropropyl)-2,6-dimethylmorpholine
4-(3-chloropropyl)-2,6-dimethylmorpholine (PubChem CID 19738017) has the molecular formula C9H18ClNO
and a molecular weight of 191.70 g/mol. Its IUPAC name is 4-(3-chloropropyl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(3-chloropropyl)-2,6-dimethylmorpholine |
| PubChem CID | 19738017 |
| Molecular Formula | C9H18ClNO |
| Molecular Weight | 191.70 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-(3-chloropropyl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(CCCCl)CC(C)O1 |
| InChI | InChI=1S/C9H18ClNO/c1-8-6-11(5-3-4-10)7-9(2)12-8/h8-9H,3-7H2,1-2H3 |
| InChIKey | UJWZJNJCHTYLND-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.70 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloropropyl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloropropyl)-2,6-dimethylmorpholine?
The IUPAC name of 4-(3-chloropropyl)-2,6-dimethylmorpholine (CID 19738017) is 4-(3-chloropropyl)-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(3-chloropropyl)-2,6-dimethylmorpholine?
The canonical SMILES for 4-(3-chloropropyl)-2,6-dimethylmorpholine is CC1CN(CCCCl)CC(C)O1.
What is the InChIKey of 4-(3-chloropropyl)-2,6-dimethylmorpholine?
The InChIKey is UJWZJNJCHTYLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClNO/c1-8-6-11(5-3-4-10)7-9(2)12-8/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-(3-chloropropyl)-2,6-dimethylmorpholine?
4-(3-chloropropyl)-2,6-dimethylmorpholine has a molecular weight of 191.70 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloropropyl)-2,6-dimethylmorpholine is sourced from PubChem (CID 19738017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).