C22H33ClN2O — CID 19738042
2-(4-chlorophenyl)-6-(2,6-dimethylmorpholin-4-yl)decanenitrile (PubChem CID 19738042) has the molecular formula C22H33ClN2O and a molecular weight of 376.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-(2,6-dimethylmorpholin-4-yl)decanenitrile.
| Compound Name | 2-(4-chlorophenyl)-6-(2,6-dimethylmorpholin-4-yl)decanenitrile |
|---|---|
| PubChem CID | 19738042 |
| Molecular Formula | C22H33ClN2O |
| Molecular Weight | 376.97 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-(4-chlorophenyl)-6-(2,6-dimethylmorpholin-4-yl)decanenitrile |
| SMILES | CCCCC(CCCC(C#N)c1ccc(Cl)cc1)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C22H33ClN2O/c1-4-5-8-22(25-15-17(2)26-18(3)16-25)9-6-7-20(14-24)19-10-12-21(23)13-11-19/h10-13,17-18,20,22H,4-9,15-16H2,1-3H3 |
| InChIKey | BOPCKUOKAXXDFW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.97 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |