C11H25N2O5P — CID 19738171
4-(2-diethoxyphosphorylethylamino)butylcarbamic acid (PubChem CID 19738171) has the molecular formula C11H25N2O5P and a molecular weight of 296.30 g/mol. Its IUPAC name is 4-(2-diethoxyphosphorylethylamino)butylcarbamic acid.
| Compound Name | 4-(2-diethoxyphosphorylethylamino)butylcarbamic acid |
|---|---|
| PubChem CID | 19738171 |
| Molecular Formula | C11H25N2O5P |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-(2-diethoxyphosphorylethylamino)butylcarbamic acid |
| SMILES | CCOP(=O)(CCNCCCCNC(=O)O)OCC |
| InChI | InChI=1S/C11H25N2O5P/c1-3-17-19(16,18-4-2)10-9-12-7-5-6-8-13-11(14)15/h12-13H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | JDFGVBVRUPCWDZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|