About 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine
3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine (PubChem CID 19738302) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 19738302 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CC1CN(CCCN(C)C)CC(C)O1 |
| InChI | InChI=1S/C11H24N2O/c1-10-8-13(9-11(2)14-10)7-5-6-12(3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | GCBTZQSOTRDMGD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine (CID 19738302) is 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine is CC1CN(CCCN(C)C)CC(C)O1.
What is the InChIKey of 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine?
The InChIKey is GCBTZQSOTRDMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-10-8-13(9-11(2)14-10)7-5-6-12(3)4/h10-11H,5-9H2,1-4H3.
What are the key properties of 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine?
3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine has a molecular weight of 200.33 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylmorpholin-4-yl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 19738302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).