About azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate
azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 19738654) has the molecular formula C24H49NO7S
and a molecular weight of 495.72 g/mol. Its IUPAC name is azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate.
Molecular Properties
| Compound Name | azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate |
| PubChem CID | 19738654 |
| Molecular Formula | C24H49NO7S |
| Molecular Weight | 495.72 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CC(C)CCCCCCCOC(=O)CC(C(=O)OCCCCCCCC(C)C)S(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C24H46O7S.H3N/c1-20(2)15-11-7-5-9-13-17-30-23(25)19-22(32(27,28)29)24(26)31-18-14-10-6-8-12-16-21(3)4;/h20-22H,5-19H2,1-4H3,(H,27,28,29);1H3 |
| InChIKey | PEWNRQODUMGNCG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate?
The IUPAC name of azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate (CID 19738654) is azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate.
What is the SMILES notation for azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate?
The canonical SMILES for azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate is CC(C)CCCCCCCOC(=O)CC(C(=O)OCCCCCCCC(C)C)S(=O)(=O)[O-].[NH4+].
What is the InChIKey of azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate?
The InChIKey is PEWNRQODUMGNCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O7S.H3N/c1-20(2)15-11-7-5-9-13-17-30-23(25)19-22(32(27,28)29)24(26)31-18-14-10-6-8-12-16-21(3)4;/h20-22H,5-19H2,1-4H3,(H,27,28,29);1H3.
What are the key properties of azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate?
azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate has a molecular weight of 495.72 g/mol, XLogP of 5.75, 20 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 1,4-bis(8-methylnonoxy)-1,4-dioxobutane-2-sulfonate is sourced from PubChem (CID 19738654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).