About 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane
8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane (PubChem CID 19739407) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 19739407 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CCCC#CC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H20O2/c1-2-3-4-5-12-6-8-13(9-7-12)14-10-11-15-13/h12H,2-3,6-11H2,1H3 |
| InChIKey | PFMAHTFPRKOLNO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane (CID 19739407) is 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane is CCCC#CC1CCC2(CC1)OCCO2.
What is the InChIKey of 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is PFMAHTFPRKOLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-2-3-4-5-12-6-8-13(9-7-12)14-10-11-15-13/h12H,2-3,6-11H2,1H3.
What are the key properties of 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane?
8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 208.30 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pent-1-ynyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 19739407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).