C15H16O6 — CID 19739486
4-[2-(2,3,4-trihydroxyphenyl)propan-2-yl]benzene-1,2,3-triol (PubChem CID 19739486) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[2-(2,3,4-trihydroxyphenyl)propan-2-yl]benzene-1,2,3-triol.
| Compound Name | 4-[2-(2,3,4-trihydroxyphenyl)propan-2-yl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 19739486 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-[2-(2,3,4-trihydroxyphenyl)propan-2-yl]benzene-1,2,3-triol |
| SMILES | CC(C)(c1ccc(O)c(O)c1O)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C15H16O6/c1-15(2,7-3-5-9(16)13(20)11(7)18)8-4-6-10(17)14(21)12(8)19/h3-6,16-21H,1-2H3 |
| InChIKey | NYIWTDSCYULDTJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|