About 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum
2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum (PubChem CID 19741694) has the molecular formula C11H16Cl2N2Pt
and a molecular weight of 442.25 g/mol. Its IUPAC name is 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum |
| PubChem CID | 19741694 |
| Molecular Formula | C11H16Cl2N2Pt |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum |
| SMILES | Cl[Pt]Cl.NCC1(N)CCc2ccccc2C1 |
| InChI | InChI=1S/C11H16N2.2ClH.Pt/c12-8-11(13)6-5-9-3-1-2-4-10(9)7-11;;;/h1-4H,5-8,12-13H2;2*1H;/q;;;+2/p-2 |
| InChIKey | LMRUUSXTTRECRP-UHFFFAOYSA-L |
| XLogP | 2.21 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum?
The IUPAC name of 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum (CID 19741694) is 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum.
What is the SMILES notation for 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum?
The canonical SMILES for 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum is Cl[Pt]Cl.NCC1(N)CCc2ccccc2C1.
What is the InChIKey of 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum?
The InChIKey is LMRUUSXTTRECRP-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H16N2.2ClH.Pt/c12-8-11(13)6-5-9-3-1-2-4-10(9)7-11;;;/h1-4H,5-8,12-13H2;2*1H;/q;;;+2/p-2.
What are the key properties of 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum?
2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum has a molecular weight of 442.25 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3,4-dihydro-1H-naphthalen-2-amine;dichloroplatinum is sourced from PubChem (CID 19741694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).