About 4-trichlorosilylphenol
4-trichlorosilylphenol (PubChem CID 19741787) has the molecular formula C6H5Cl3OSi
and a molecular weight of 227.55 g/mol. Its IUPAC name is 4-trichlorosilylphenol.
Molecular Properties
| Compound Name | 4-trichlorosilylphenol |
| PubChem CID | 19741787 |
| Molecular Formula | C6H5Cl3OSi |
| Molecular Weight | 227.55 g/mol |
| Exact Mass | 225.92 |
| IUPAC Name | 4-trichlorosilylphenol |
| SMILES | Oc1ccc([Si](Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C6H5Cl3OSi/c7-11(8,9)6-3-1-5(10)2-4-6/h1-4,10H |
| InChIKey | XLNXFMXEYPPKIB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 4-trichlorosilylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-trichlorosilylphenol?
The IUPAC name of 4-trichlorosilylphenol (CID 19741787) is 4-trichlorosilylphenol.
What is the SMILES notation for 4-trichlorosilylphenol?
The canonical SMILES for 4-trichlorosilylphenol is Oc1ccc([Si](Cl)(Cl)Cl)cc1.
What is the InChIKey of 4-trichlorosilylphenol?
The InChIKey is XLNXFMXEYPPKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl3OSi/c7-11(8,9)6-3-1-5(10)2-4-6/h1-4,10H.
What are the key properties of 4-trichlorosilylphenol?
4-trichlorosilylphenol has a molecular weight of 227.55 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-trichlorosilylphenol is sourced from PubChem (CID 19741787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).