C44H78N4O8 — CID 19741801
tetrakis(1,2,2,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 19741801) has the molecular formula C44H78N4O8 and a molecular weight of 791.13 g/mol. Its IUPAC name is tetrakis(1,2,2,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | tetrakis(1,2,2,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 19741801 |
| Molecular Formula | C44H78N4O8 |
| Molecular Weight | 791.13 g/mol |
| Exact Mass | 790.58 |
| IUPAC Name | tetrakis(1,2,2,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | CC1CC(OC(=O)CC(C(=O)OC2CC(C)N(C)C(C)(C)C2)C(CC(=O)OC2CC(C)N(C)C(C)(C)C2)C(=O)OC2CC(C)N(C)C(C)(C)C2)CC(C)(C)N1C |
| InChI | InChI=1S/C44H78N4O8/c1-27-17-31(23-41(5,6)45(27)13)53-37(49)21-35(39(51)55-33-19-29(3)47(15)43(9,10)25-33)36(40(52)56-34-20-30(4)48(16)44(11,12)26-34)22-38(50)54-32-18-28(2)46(14)42(7,8)24-32/h27-36H,17-26H2,1-16H3 |
| InChIKey | AULAFQWUVAZTQR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.13 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|