C19H37N5 — CID 19741922
2-cyano-1-octyl-1-(2,2,6,6-tetramethylpiperidin-1-yl)guanidine (PubChem CID 19741922) has the molecular formula C19H37N5 and a molecular weight of 335.54 g/mol. Its IUPAC name is 2-cyano-1-octyl-1-(2,2,6,6-tetramethylpiperidin-1-yl)guanidine.
| Compound Name | 2-cyano-1-octyl-1-(2,2,6,6-tetramethylpiperidin-1-yl)guanidine |
|---|---|
| PubChem CID | 19741922 |
| Molecular Formula | C19H37N5 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.30 |
| IUPAC Name | 2-cyano-1-octyl-1-(2,2,6,6-tetramethylpiperidin-1-yl)guanidine |
| SMILES | CCCCCCCCN(/C(N)=N/C#N)N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C19H37N5/c1-6-7-8-9-10-11-15-23(17(21)22-16-20)24-18(2,3)13-12-14-19(24,4)5/h6-15H2,1-5H3,(H2,21,22) |
| InChIKey | JFFNQWVAMLOCEY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|