C39H55NO5P2 — CID 19742179
1-benzyl-2,8-bis(2,4-ditert-butylphenoxy)-3,7,9-trioxa-1-aza-2,8-diphosphaspiro[4.5]decane (PubChem CID 19742179) has the molecular formula C39H55NO5P2 and a molecular weight of 679.82 g/mol. Its IUPAC name is 1-benzyl-2,8-bis(2,4-ditert-butylphenoxy)-3,7,9-trioxa-1-aza-2,8-diphosphaspiro[4.5]decane.
| Compound Name | 1-benzyl-2,8-bis(2,4-ditert-butylphenoxy)-3,7,9-trioxa-1-aza-2,8-diphosphaspiro[4.5]decane |
|---|---|
| PubChem CID | 19742179 |
| Molecular Formula | C39H55NO5P2 |
| Molecular Weight | 679.82 g/mol |
| Exact Mass | 679.36 |
| IUPAC Name | 1-benzyl-2,8-bis(2,4-ditert-butylphenoxy)-3,7,9-trioxa-1-aza-2,8-diphosphaspiro[4.5]decane |
| SMILES | CC(C)(C)c1ccc(OP2OCC3(CO2)COP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)N3Cc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C39H55NO5P2/c1-35(2,3)29-18-20-33(31(22-29)37(7,8)9)44-46-40(24-28-16-14-13-15-17-28)39(25-41-46)26-42-47(43-27-39)45-34-21-19-30(36(4,5)6)23-32(34)38(10,11)12/h13-23H,24-27H2,1-12H3 |
| InChIKey | ILWYFXDGQZMLDW-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.82 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|